4,4-Dibromo-2,6-di-tert-butylcyclohexa-2,5-dienone structure
|
Common Name | 4,4-Dibromo-2,6-di-tert-butylcyclohexa-2,5-dienone | ||
|---|---|---|---|---|
| CAS Number | 1144-36-1 | Molecular Weight | 364.11600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H20Br2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,4-Dibromo-2,6-di-tert-butylcyclohexa-2,5-dienone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H20Br2O |
|---|---|
| Molecular Weight | 364.11600 |
| Exact Mass | 361.98800 |
| PSA | 17.07000 |
| LogP | 5.00020 |
| InChIKey | WRRFKBTXZIRGSF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(Br)(Br)C=C(C(C)(C)C)C1=O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914700090 |
|
~%
4,4-Dibromo-2,6... CAS#:1144-36-1 |
| Literature: Rieker,A. et al. Z. Naturforsch., B: Anorg. Chem., Org. Chem., Biochem., Biophys.,, 1969 , vol. 24, p. 547 - 562 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4,4-dibromo-2,6-ditert-butylcyclohexa-2,5-dien-1-one |