4-Bromo-2,6-di-tert-butylphenol structure
|
Common Name | 4-Bromo-2,6-di-tert-butylphenol | ||
|---|---|---|---|---|
| CAS Number | 1139-52-2 | Molecular Weight | 285.22000 | |
| Density | 1.201 g/cm3 | Boiling Point | 128 °C / 4mmHg | |
| Molecular Formula | C14H21BrO | Melting Point | 78-83 °C (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 119.4ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-Bromo-2,6-di-tert-butylphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.201 g/cm3 |
|---|---|
| Boiling Point | 128 °C / 4mmHg |
| Melting Point | 78-83 °C (dec.)(lit.) |
| Molecular Formula | C14H21BrO |
| Molecular Weight | 285.22000 |
| Flash Point | 119.4ºC |
| Exact Mass | 284.07800 |
| PSA | 20.23000 |
| LogP | 4.74970 |
| Vapour Pressure | 0.00333mmHg at 25°C |
| Index of Refraction | 1.523 |
| InChIKey | SSQQUEKFNSJLKX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(Br)cc(C(C)(C)C)c1O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2908199090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2908199090 |
|---|---|
| Summary | HS: 2908199090. derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
|
Phase transfer catalyzed polymerization of 4-bromo-2, 6-dimethylphenol in the presence of a terminating comonomer phenol: 2, 4, 6-tri-tert-butylphenol or 4-bromo-2, 6-di-tert-butylphenol. Wang JH and Percec V.
Polym. Bull. 25(1) , 33-40, (1991)
|
|
|
Photolysis of 4-bromo-2, 6-di-tert-butylphenol in benzene solution. Lappin GR and Zannucci JS.
Tetrahedron Lett. 10(58) , 5085-5087, (1969)
|
|
|
Effect of donor and acceptor on the mechanism of a photochemical reaction in doped single crystals for radical pairs in 4-bromo-2, 6-di-tert-butylphenol single crystal doped with 2, 6-di-tert-butyl-p-quinone. Tipikin DS, et al.
Kinet. Catal. 42(2) , 246-250, (2001)
|
| 4-bromo-2,6-ditert-butylphenol |
| 2,6-Di-tert-butyl-4-bromophenol |
| EINECS 214-521-8 |
| 4-BroMo-2,6-di-tert-butylphenol |
| MFCD00051598 |