Ganoderiol F structure
|
Common Name | Ganoderiol F | ||
|---|---|---|---|---|
| CAS Number | 114567-47-4 | Molecular Weight | 454.684 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 598.3±50.0 °C at 760 mmHg | |
| Molecular Formula | C30H46O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 329.7±26.6 °C | |
Use of Ganoderiol FGanoderiol F, a tetracyclic triterpene, is isolated from Ganoderma amboinense and found to induce senescence of cancer cell lines[1]. |
| Name | (5R,10S,13R,14R,17R)-17-[(2R)-7-hydroxy-6-(hydroxymethyl)hept-5-en-2-yl]-4,4,10,13,14-pentamethyl-1,2,5,6,12,15,16,17-octahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| Synonym | More Synonyms |
| Description | Ganoderiol F, a tetracyclic triterpene, is isolated from Ganoderma amboinense and found to induce senescence of cancer cell lines[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 598.3±50.0 °C at 760 mmHg |
| Molecular Formula | C30H46O3 |
| Molecular Weight | 454.684 |
| Flash Point | 329.7±26.6 °C |
| Exact Mass | 454.344696 |
| PSA | 57.53000 |
| LogP | 7.48 |
| Vapour Pressure | 0.0±3.8 mmHg at 25°C |
| Index of Refraction | 1.558 |
| InChIKey | JVGJXXNUVVQEIG-MCKXIFHVSA-N |
| SMILES | CC(CCC=C(CO)CO)C1CCC2(C)C3=CCC4C(C)(C)C(=O)CCC4(C)C3=CCC12C |
| Hazard Codes | Xi |
|---|
| Ganoderiol F |
| Lanosta-7,9(11),24-trien-3-one, 26,27-dihydroxy- |
| 26,27-Dihydroxylanosta-7,9(11),24-trien-3-one |