Illudin M structure
|
Common Name | Illudin M | ||
|---|---|---|---|---|
| CAS Number | 1146-04-9 | Molecular Weight | 248.31700 | |
| Density | 1.24g/cm3 | Boiling Point | 452.4ºC at 760mmHg | |
| Molecular Formula | C15H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.5ºC | |
Use of Illudin MIlludin M is a cytotoxic fungal sesquiterpene that can be isolated from the culture medium of Omphalotus olearius mushrooms. Illudin M can alkylate DNA. Illudin M has anti-tumor activities[1][2]. |
| Name | Spiro[cyclopropane-1,5'-[5H]inden]-7'(6'H)-one, 2',3'-dihydro-3',6'-dihydroxy-2',2',4',6'-tetramethyl-,(3'S-trans) |
|---|---|
| Synonym | More Synonyms |
| Description | Illudin M is a cytotoxic fungal sesquiterpene that can be isolated from the culture medium of Omphalotus olearius mushrooms. Illudin M can alkylate DNA. Illudin M has anti-tumor activities[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Illudin M (0.01-10 μM; 24-120 hours) shows cytotoxicity and induction of apoptosis in vitro[1]. Apoptosis Analysis[1] Cell Line: Panc-1 pancreatic carcinoma, HT-29 colon adenocarcinoma, non-malignant human foreskin fibroblasts (HFs) Concentration: 0.01 μM, 1 μM, 10 μM Incubation Time: 24 hours, 48 hours,72 hours, 96 hours, 120 hours Result: Showed a comparable induction of apoptosis in the tumour cells (86% in Panc-1; 48% in HT-29), but an even greater one in the HF (89%). |
| References |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 452.4ºC at 760mmHg |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.31700 |
| Flash Point | 241.5ºC |
| Exact Mass | 248.14100 |
| PSA | 57.53000 |
| LogP | 1.74390 |
| Vapour Pressure | 4.36E-10mmHg at 25°C |
| Index of Refraction | 1.593 |
| InChIKey | QVMDIQLUNODCTG-OCCSQVGLSA-N |
| SMILES | CC1=C2C(=CC(C)(C)C2O)C(=O)C(C)(O)C12CC2 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| illudin M |
| (3'S,6'R)-2',3'-Dihydro-3',6'-dihydroxy-2',2',4',6'-tetramethylspiro[cyclopropane-1,5'-[5H]inden]-7'(6'H)-one |
| (3'S,6'R)-2',3'-Dihydro-2',2',4',6'-tetramethylspiro(cyclopropane-1,5'-[5H]inden)-7'(6'H)-one |