2'-Aminobenzophenone-2-carboxylic Acid structure
|
Common Name | 2'-Aminobenzophenone-2-carboxylic Acid | ||
|---|---|---|---|---|
| CAS Number | 1147-43-9 | Molecular Weight | 241.24200 | |
| Density | 1.322 g/cm3 | Boiling Point | 520.9ºC at 760 mmHg | |
| Molecular Formula | C14H11NO3 | Melting Point | 196-199 °C (dec.)(lit.) | |
| MSDS | USA | Flash Point | 268.8ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-aminobenzophenone-2'-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.322 g/cm3 |
|---|---|
| Boiling Point | 520.9ºC at 760 mmHg |
| Melting Point | 196-199 °C (dec.)(lit.) |
| Molecular Formula | C14H11NO3 |
| Molecular Weight | 241.24200 |
| Flash Point | 268.8ºC |
| Exact Mass | 241.07400 |
| PSA | 80.39000 |
| LogP | 2.77920 |
| Vapour Pressure | 1.12E-11mmHg at 25°C |
| InChIKey | KORKIRUGUNPQML-UHFFFAOYSA-N |
| SMILES | Nc1ccccc1C(=O)c1ccccc1C(=O)O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2922509090 |
|
~%
2'-Aminobenzoph... CAS#:1147-43-9 |
| Literature: Collection of Czechoslovak Chemical Communications, , vol. 47, # 6 p. 1746 - 1756 |
|
~%
2'-Aminobenzoph... CAS#:1147-43-9 |
| Literature: DE258343 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 11, p. 565 |
| Precursor 2 | |
|---|---|
| DownStream 10 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Aminobenzophenone-2′-carboxylic acid |
| 2-Anthraniloylbenzoic Acid |
| 2-Aminobenzophenone-2'-carboxylic acid |
| EINECS 214-554-8 |
| MFCD00007715 |
| 2-(2-aminobenzoyl)benzoic acid |
| 2'-Aminobenzophenone-2-carboxylic Acid |