1,4-Dimesidinoanthraquinone structure
|
Common Name | 1,4-Dimesidinoanthraquinone | ||
|---|---|---|---|---|
| CAS Number | 116-75-6 | Molecular Weight | 474.593 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 639.5±55.0 °C at 760 mmHg | |
| Molecular Formula | C32H30N2O2 | Melting Point | 236.5-237.5 °C | |
| MSDS | N/A | Flash Point | 168.9±31.7 °C | |
| Name | Solvent Blue 104 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 639.5±55.0 °C at 760 mmHg |
| Melting Point | 236.5-237.5 °C |
| Molecular Formula | C32H30N2O2 |
| Molecular Weight | 474.593 |
| Flash Point | 168.9±31.7 °C |
| Exact Mass | 474.230713 |
| PSA | 58.20000 |
| LogP | 7.25 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.677 |
| InChIKey | DMDRBXCDTZRMHZ-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(Nc2ccc(Nc3c(C)cc(C)cc3C)c3c2C(=O)c2ccccc2C3=O)c(C)c1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R10:Flammable. R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | S16-S26-S36/37/39-S37/39 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 3 |
| HS Code | 3204199000 |
|
~%
1,4-Dimesidinoa... CAS#:116-75-6 |
| Literature: Zhurnal Obshchei Khimii, , vol. 25, p. 617,621; engl. Ausg. S. 589, 591 |
|
~83%
1,4-Dimesidinoa... CAS#:116-75-6 |
| Literature: LANXESS Deutschland GmbH Patent: US2008/139830 A1, 2008 ; Location in patent: Page/Page column 4 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 3204199000 |
|---|
| 1,4-Bis(mesitylamino)-9,10-anthraquinone |
| Transparent Blue BB |
| 1,4-Dimesidinoanthraquinone |
| Elbaplast Blue R |
| EINECS 204-155-7 |
| 1,4-Bis(2,4,6-trimethylanilino)anthraquinone |
| Keyplast Blue KR |
| 1,4-Bis-(2,4,6-trimethyl-phenylamino)-anthraquinone |
| Snadoplast Blue 2BP |
| Sandoplast Blue 2B. |