BioA-IN-13 structure
|
Common Name | BioA-IN-13 | ||
|---|---|---|---|---|
| CAS Number | 1164475-61-9 | Molecular Weight | 368.41 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H16N2O4S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of BioA-IN-13BioA-IN-13 is a potent, cell permeable and whole-cell active inhibitor of Mycobacterium tuberculosis BioA enzyme[1]. |
| Name | BioA-IN-13 |
|---|
| Description | BioA-IN-13 is a potent, cell permeable and whole-cell active inhibitor of Mycobacterium tuberculosis BioA enzyme[1]. |
|---|---|
| Related Catalog | |
| Target |
Target: BioA enzyme[1] |
| References |
| Molecular Formula | C19H16N2O4S |
|---|---|
| Molecular Weight | 368.41 |
| InChIKey | XEFQYEIZGTWFCR-GXDHUFHOSA-N |
| SMILES | Cc1ccc(C=C(CCC(=O)O)c2nc3ccccc3s2)cc1[N+](=O)[O-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 |
| Precautionary Statements | P301 + P312 + P330 |
| RIDADR | NONH for all modes of transport |