PTP1B-IN-13 structure
|
Common Name | PTP1B-IN-13 | ||
|---|---|---|---|---|
| CAS Number | 650621-20-8 | Molecular Weight | 467.60 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C24H25N3O3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PTP1B-IN-13PTP1B-IN-13 is a selective PTP1B inhibitor targeting the allosteric site with an IC50 value of 1.59 μM. |
| Name | N-({4-[(3,4-Dimethylphenyl)sulfamoyl]phenyl}carbamothioyl)-3-phenylpropanamide |
|---|---|
| Synonym | More Synonyms |
| Description | PTP1B-IN-13 is a selective PTP1B inhibitor targeting the allosteric site with an IC50 value of 1.59 μM. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Molecular Formula | C24H25N3O3S2 |
| Molecular Weight | 467.60 |
| Exact Mass | 467.133728 |
| LogP | 5.24 |
| Index of Refraction | 1.667 |
| InChIKey | ZNWJPVHKYGKNLY-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(NC(=S)NC(=O)CCc3ccccc3)cc2)cc1C |
| Benzenepropanamide, N-[[[4-[[(3,4-dimethylphenyl)amino]sulfonyl]phenyl]amino]thioxomethyl]- |
| MFCD04104932 |
| N-({4-[(3,4-Dimethylphenyl)sulfamoyl]phenyl}carbamothioyl)-3-phenylpropanamide |
| PTP1B-IN-13 |