Busulfan-D8
Modify Date: 2025-08-25 18:54:11
Busulfan-D8 structure
|
Common Name | Busulfan-D8 | ||
|---|---|---|---|---|
| CAS Number | 116653-28-2 | Molecular Weight | 254.351 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 464.0±28.0 °C at 760 mmHg | |
| Molecular Formula | C6H6D8O6S2 | Melting Point | 112-114ºC | |
| MSDS | N/A | Flash Point | 234.4±24.0 °C | |
Use of Busulfan-D8Busulfan-D8 is a deuterium labeled Busulfan. Busulfan is an alkyl sulfonate that acts as an alkylating antineoplastic agent. Busulfan forms both intra- and interstrand crosslinks on DNA. In mammals, Busulfan causes profound and prolonged reduction in the generation of hematopoietic progenitors without significantly affecting lymphocyte levels or humoral antibody responses. |
| Name | (1,1,2,2,3,3,4,4-octadeuterio-4-methylsulfonyloxybutyl) methanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Description | Busulfan-D8 is a deuterium labeled Busulfan. Busulfan is an alkyl sulfonate that acts as an alkylating antineoplastic agent. Busulfan forms both intra- and interstrand crosslinks on DNA. In mammals, Busulfan causes profound and prolonged reduction in the generation of hematopoietic progenitors without significantly affecting lymphocyte levels or humoral antibody responses. |
|---|---|
| Related Catalog |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 464.0±28.0 °C at 760 mmHg |
| Melting Point | 112-114ºC |
| Molecular Formula | C6H6D8O6S2 |
| Molecular Weight | 254.351 |
| Flash Point | 234.4±24.0 °C |
| Exact Mass | 254.073395 |
| PSA | 103.50000 |
| LogP | -0.52 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.471 |
| InChIKey | COVZYZSDYWQREU-SQUIKQQTSA-N |
| SMILES | CS(=O)(=O)OCCCCOS(C)(=O)=O |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (H)Butane-1,4-diyl dimethanesulfonate |
| Busulfan-d8 |
| 1,4-Butane-d-diol, dimethanesulfonate |
| Myleran-d8 |
| Busulphan-d8 |
| d8-butane-1,4-diol-1,4-dimethane sulfonate |
| Misulban-d8 |
| GT-41-d8 |
| 1,4-Butanediol-d8-dimethanesulfonate Esters |
| (H)-1,4-Butanediyl dimethanesulfonate |
| Busulfex-d8 |
| CB-2041-d8 |
| d8-butane-1,4-dimesylate |