(4-methoxyphenyl)-diphenylsulfanium,trifluoromethanesulfonate structure
|
Common Name | (4-methoxyphenyl)-diphenylsulfanium,trifluoromethanesulfonate | ||
|---|---|---|---|---|
| CAS Number | 116808-67-4 | Molecular Weight | 442.47200 | |
| Density | 1.29g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C20H17F3O4S2 | Melting Point | 101-104 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (4-methoxyphenyl)-diphenylsulfanium,trifluoromethanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Melting Point | 101-104 °C(lit.) |
| Molecular Formula | C20H17F3O4S2 |
| Molecular Weight | 442.47200 |
| Exact Mass | 442.05200 |
| PSA | 100.11000 |
| LogP | 5.92280 |
| Index of Refraction | 1.543 |
| InChIKey | WBUSZOLVSDXDOC-UHFFFAOYSA-M |
| SMILES | COc1ccc([S+](c2ccccc2)c2ccccc2)cc1.O=S(=O)([O-])C(F)(F)F |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi,C |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
~40%
(4-methoxypheny... CAS#:116808-67-4 |
| Literature: Miller, R. D.; Renaldo, A. F.; Ito, H. Journal of Organic Chemistry, 1988 , vol. 53, # 23 p. 5571 - 5573 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| diphenyl-p-methoxyphenylsulfonium triflate |
| (4-Methoxyphenyl)diphenylsulfonium trifluoromethanesulfonate |
| MFCD02683565 |