Duloxetine hydrochloride structure
|
Common Name | Duloxetine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 116817-11-9 | Molecular Weight | 333.875 | |
| Density | N/A | Boiling Point | 466.2ºC at 760 mmHg | |
| Molecular Formula | C18H20ClNOS | Melting Point | 118-122ºC | |
| MSDS | N/A | Flash Point | 235.7ºC | |
| Name | N-methyl-3-naphthalen-1-yloxy-3-thiophen-2-ylpropan-1-amine,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 466.2ºC at 760 mmHg |
|---|---|
| Melting Point | 118-122ºC |
| Molecular Formula | C18H20ClNOS |
| Molecular Weight | 333.875 |
| Flash Point | 235.7ºC |
| Exact Mass | 333.095398 |
| PSA | 49.50000 |
| LogP | 5.82380 |
| Vapour Pressure | 7.23E-09mmHg at 25°C |
| InChIKey | BFFSMCNJSOPUAY-UHFFFAOYSA-N |
| SMILES | C[NH2+]CCC(Oc1cccc2ccccc12)c1cccs1.[Cl-] |
| HS Code | 2934999090 |
|---|
|
~81%
Duloxetine hydr... CAS#:116817-11-9 |
| Literature: ZENTIVA, A.S. Patent: WO2006/45255 A1, 2006 ; Location in patent: Page/Page column 5 ; |
|
~%
Duloxetine hydr... CAS#:116817-11-9 |
| Literature: US2013/53579 A1, ; Paragraph 0070 ; |
|
~82%
Duloxetine hydr... CAS#:116817-11-9 |
| Literature: Chen, Shao-Rui; Li, Ai-Jun; Chen, Ming-Ming Asian Journal of Chemistry, 2012 , vol. 24, # 4 p. 1680 - 1684 |
|
~%
Duloxetine hydr... CAS#:116817-11-9 |
| Literature: US2013/53579 A1, ; Paragraph 0071-0074 ; |
|
~%
Duloxetine hydr... CAS#:116817-11-9 |
| Literature: Bioorganic and medicinal chemistry letters, , vol. 13, # 24 p. 4477 - 4480 |
|
~%
Duloxetine hydr... CAS#:116817-11-9 |
| Literature: Bioorganic and medicinal chemistry letters, , vol. 13, # 24 p. 4477 - 4480 |
|
~%
Duloxetine hydr... CAS#:116817-11-9 |
| Literature: Asian Journal of Chemistry, , vol. 24, # 4 p. 1680 - 1684 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-Methyl-3-(1-naphthyloxy)-3-(2-thienyl)propan-1-amine hydrochloride (1:1) |
| N,N-dimethylamino-3-(1-naphthanyloxy)-3-(2-thienyl)-1-propanamine |
| (R,S)-Duloxetine hydrochloride |
| N,N-dimethyl-3-(1-naphthalenyloxy)-3-(thien-2-yl)propanamine |
| (RS)-N,N-dimethyl-3-(1-naphthyloxy)-3-(2-thienyl)propylamine |
| N,N-dimethyl-3-(1-naphthyloxy)-3-(2-thienyl)propylamine |
| N-Methyl-3-(1-naphthyloxy)-3-(2-thienyl)-1-propanamine hydrochloride (1:1) |
| N-methyl-3-(1-naphthalenyloxy)-3-thiophen-2-yl-1-propanamine hydrochloride |
| N-methyl-3-naphthalen-1-yloxy-3-thiophen-2-yl-propan-1-amine hydrochloride |
| 2-Thiophenepropanamine, N-methyl-γ-(1-naphthalenyloxy)-, hydrochloride (1:1) |
| N,N-dimethyl-3-(1-naphthalenyloxy)-3-(2-thienyl)-propanamine |
| (S)-duloxetine hydrochloride |
| Duloxetine hydrochloride |
| (RS)Duloxetine HCl |