Previtamin D3 structure
|
Common Name | Previtamin D3 | ||
|---|---|---|---|---|
| CAS Number | 1173-13-3 | Molecular Weight | 384.63800 | |
| Density | 1.017g/cm3 | Boiling Point | 496ºC at 760mmHg | |
| Molecular Formula | C27H44O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.1ºC | |
Use of Previtamin D3Previtamin D3 is an intermediate in the production of cholecalciferol (vitamin D3)[1]. |
| Name | Previtamin D3 |
|---|---|
| Synonym | More Synonyms |
| Description | Previtamin D3 is an intermediate in the production of cholecalciferol (vitamin D3)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.017g/cm3 |
|---|---|
| Boiling Point | 496ºC at 760mmHg |
| Molecular Formula | C27H44O |
| Molecular Weight | 384.63800 |
| Flash Point | 214.1ºC |
| Exact Mass | 384.33900 |
| PSA | 20.23000 |
| LogP | 7.61900 |
| Vapour Pressure | 6.45E-12mmHg at 25°C |
| Index of Refraction | 1.576 |
| InChIKey | YUGCAAVRZWBXEQ-WHTXLNIXSA-N |
| SMILES | CC1=C(C=CC2=CCCC3(C)C2CCC3C(C)CCCC(C)C)CC(O)CC1 |
| Hazard Codes | T |
|---|
| Precursor 0 | |
|---|---|
| DownStream 4 | |
| EINECS 214-634-2 |
| (1S)-3-[(Z)-2-[(1R,3aR,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,6,7-hexahydroinden-4-yl]ethenyl]-4-methylcyclohex-3-en-1-ol |