leucomalachite green d6 structure
|
Common Name | leucomalachite green d6 | ||
|---|---|---|---|---|
| CAS Number | 1173021-13-0 | Molecular Weight | 336.50 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H20D6N2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
Use of leucomalachite green d6Leucomalachite green-d6 is the deuterium labeled Fmoc-Gly-OH[1]. |
| Name | 4-[deuterio-[4-(dimethylamino)phenyl]-(2,3,4,5,6-pentadeuteriophenyl)methyl]-N,N-dimethylaniline |
|---|---|
| Synonym | More Synonyms |
| Description | Leucomalachite green-d6 is the deuterium labeled Fmoc-Gly-OH[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[75]. |
| References |
| Molecular Formula | C23H20D6N2 |
|---|---|
| Molecular Weight | 336.50 |
| Exact Mass | 336.24700 |
| PSA | 6.48000 |
| LogP | 4.99880 |
| InChIKey | WZKXBGJNNCGHIC-OOBYGUTHSA-N |
| SMILES | CN(C)c1ccc(C(c2ccccc2)c2ccc(N(C)C)cc2)cc1 |
| Leucomalachite Green-d6 |