4,6-Dihydroxynaphthalene-2-sulphonic acid structure
|
Common Name | 4,6-Dihydroxynaphthalene-2-sulphonic acid | ||
|---|---|---|---|---|
| CAS Number | 6357-93-3 | Molecular Weight | 240.23300 | |
| Density | 1.677 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H8O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,6-dihydroxynaphthalene-2-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.677 g/cm3 |
|---|---|
| Molecular Formula | C10H8O5S |
| Molecular Weight | 240.23300 |
| Exact Mass | 240.00900 |
| PSA | 103.21000 |
| LogP | 2.57850 |
| Index of Refraction | 1.702 |
| InChIKey | FBYMBFPXCCVIRA-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)c1cc(O)c2cc(O)ccc2c1 |
| HS Code | 2908999090 |
|---|
|
~%
4,6-Dihydroxyna... CAS#:6357-93-3 |
| Literature: , ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 2, p. 274 DE62964 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 3, p. 497 |
|
~%
4,6-Dihydroxyna... CAS#:6357-93-3 |
| Literature: Journal fuer Praktische Chemie (Leipzig), , vol. <2> 75, p. 288 |
|
~%
4,6-Dihydroxyna... CAS#:6357-93-3 |
| Literature: Journal fuer Praktische Chemie (Leipzig), , vol. <2> 75, p. 288 |
|
~%
4,6-Dihydroxyna... CAS#:6357-93-3 |
| Literature: Journal fuer Praktische Chemie (Leipzig), , vol. <2> 75, p. 288 |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 2,8-Dihydroxy-6-sulpho naphthalene |
| 4,6-Dihydroxynaphthalene-2-sulphonic acid |
| 2,8-dihydroxynaphthalene-6-sulphonic acid |
| 4,6-dihydroxy-naphthalene-2-sulfonic acid |
| 1-hydroxy-3-sulpho-7-hydroxy-naphthalene |
| 4,6-Dihydroxy-naphthalin-2-sulfonsaeure |
| DIHYDROXY-G-SALT |
| EINECS 228-757-4 |
| 2,8-dihydroxynaphthalene-6-sulfonic acid |
| DIOXY G ACID |