Fmoc-NH-(PEG)9-CH2CH2COOH structure
|
Common Name | Fmoc-NH-(PEG)9-CH2CH2COOH | ||
|---|---|---|---|---|
| CAS Number | 1191064-81-9 | Molecular Weight | 707.805 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 803.9±65.0 °C at 760 mmHg | |
| Molecular Formula | C36H53NO13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 440.0±34.3 °C | |
Use of Fmoc-NH-(PEG)9-CH2CH2COOHFmoc-NH-PEG9-CH2CH2COOH is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | 1-(9H-Fluoren-9-yl)-3-oxo-2,7,10,13,16,19,22,25,28,31-decaoxa-4-azatetratriacontan-34-oic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Fmoc-NH-PEG9-CH2CH2COOH is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 803.9±65.0 °C at 760 mmHg |
| Molecular Formula | C36H53NO13 |
| Molecular Weight | 707.805 |
| Flash Point | 440.0±34.3 °C |
| Exact Mass | 707.351685 |
| LogP | 0.51 |
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |
| Index of Refraction | 1.526 |
| InChIKey | NEESTRVILHNOJT-UHFFFAOYSA-N |
| SMILES | O=C(O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCNC(=O)OCC1c2ccccc2-c2ccccc21 |
| 2,7,10,13,16,19,22,25,28,31-Decaoxa-4-azatetratriacontan-34-oic acid, 1-(9H-fluoren-9-yl)-3-oxo- |
| 1-(9H-Fluoren-9-yl)-3-oxo-2,7,10,13,16,19,22,25,28,31-decaoxa-4-azatetratriacontan-34-oic acid |