|   Fmoc-NH-(PEG)9-CH2CH2COOH structure | Common Name | Fmoc-NH-(PEG)9-CH2CH2COOH | ||
|---|---|---|---|---|
| CAS Number | 1191064-81-9 | Molecular Weight | 707.805 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 803.9±65.0 °C at 760 mmHg | |
| Molecular Formula | C36H53NO13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 440.0±34.3 °C | |
| Use of Fmoc-NH-(PEG)9-CH2CH2COOHFmoc-NH-PEG9-CH2CH2COOH is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. | 
| Name | 1-(9H-Fluoren-9-yl)-3-oxo-2,7,10,13,16,19,22,25,28,31-decaoxa-4-azatetratriacontan-34-oic acid | 
|---|---|
| Synonym | More Synonyms | 
| Description | Fmoc-NH-PEG9-CH2CH2COOH is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. | 
|---|---|
| Related Catalog | |
| Target | Cleavable | 
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker. | 
| References | 
| Density | 1.2±0.1 g/cm3 | 
|---|---|
| Boiling Point | 803.9±65.0 °C at 760 mmHg | 
| Molecular Formula | C36H53NO13 | 
| Molecular Weight | 707.805 | 
| Flash Point | 440.0±34.3 °C | 
| Exact Mass | 707.351685 | 
| LogP | 0.51 | 
| Vapour Pressure | 0.0±3.0 mmHg at 25°C | 
| Index of Refraction | 1.526 | 
| 2,7,10,13,16,19,22,25,28,31-Decaoxa-4-azatetratriacontan-34-oic acid, 1-(9H-fluoren-9-yl)-3-oxo- | 
| 1-(9H-Fluoren-9-yl)-3-oxo-2,7,10,13,16,19,22,25,28,31-decaoxa-4-azatetratriacontan-34-oic acid |