Donepezil Hydrochloride structure
|
Common Name | Donepezil Hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 120011-70-3 | Molecular Weight | 415.953 | |
| Density | N/A | Boiling Point | 527.9ºC at 760 mmHg | |
| Molecular Formula | C24H30ClNO3 | Melting Point | 220-222ºC | |
| MSDS | USA | Flash Point | 273.1ºC | |
Use of Donepezil HydrochlorideDonepezil Hcl(E-2020) is a noncompetitive acetylcholinesterase inhibitor, which can readily cross the blood brain barrier and increases the concentration of cortical acetylcholine. IC50 Value:Target: AChEIt is known that Donepezil Hydrochloride is a useful tool in the study of Alzheimer's disease. Studies indicate that Donepezil Hydrochloride protects the brain against diisopropylfluorophosphate-induced effects. Studies indicate that Donepezil Hydrochloride selectively inhibits acetylcholinesterase, whereas it has little effect on butyrylcholinesterase. Alternate studies suggest that Donepezil Hydrochloride increases the concentration of extracellular acetylcholine in the cerebral cortex and hippocampus of rats. |
| Name | donepezil hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | Donepezil Hcl(E-2020) is a noncompetitive acetylcholinesterase inhibitor, which can readily cross the blood brain barrier and increases the concentration of cortical acetylcholine. IC50 Value:Target: AChEIt is known that Donepezil Hydrochloride is a useful tool in the study of Alzheimer's disease. Studies indicate that Donepezil Hydrochloride protects the brain against diisopropylfluorophosphate-induced effects. Studies indicate that Donepezil Hydrochloride selectively inhibits acetylcholinesterase, whereas it has little effect on butyrylcholinesterase. Alternate studies suggest that Donepezil Hydrochloride increases the concentration of extracellular acetylcholine in the cerebral cortex and hippocampus of rats. |
|---|---|
| Related Catalog | |
| References |
| Boiling Point | 527.9ºC at 760 mmHg |
|---|---|
| Melting Point | 220-222ºC |
| Molecular Formula | C24H30ClNO3 |
| Molecular Weight | 415.953 |
| Flash Point | 273.1ºC |
| Exact Mass | 415.191437 |
| PSA | 38.77000 |
| LogP | 5.10100 |
| Vapour Pressure | 3.11E-11mmHg at 25°C |
| InChIKey | XWAIAVWHZJNZQQ-UHFFFAOYSA-N |
| SMILES | COc1cc2c(cc1OC)C(=O)C(CC1CCN(Cc3ccccc3)CC1)C2.Cl |
| Storage condition | -20°C Freezer |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | UN 2811 |
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(1-Benzyl-4-piperidylmethyl)-5,6-dimethoxy-1-indanone Hydrochloride |
| MFCD00881312 |
| 2-[(1-benzylpiperidin-4-yl)methyl]-5,6-dimethoxy-2,3-dihydro-1H-inden-1-one hydrochloride (1:1) |
| 2-[(1-Benzyl-4-piperidinyl)methyl]-5,6-dimethoxy-1-indanone hydrochloride (1:1) |
| 2-[(1-benzylpiperidin-4-yl)methyl]-5,6-dimethoxyindan-1-one hydrochloride |
| 5,6-Dimethoxy-2-[[1-(phenylmethyl)-4-piperidinyl]methyl]-2,3-dihydro-1H-inden-1-one Hydrochloride |
| 2-((1-Benzylpiperidin-4-yl)methyl)-5,6-dimethoxy-2,3-dihydro-1H-inden-1-one hydrochloride |
| 1H-Inden-1-one, 2,3-dihydro-5,6-dimethoxy-2-[[1-(phenylmethyl)-4-piperidinyl]methyl]-, hydrochloride (1:1) |
| 2-[(1-Benzylpiperidin-4-yl)methyl]-5,6-dimethoxy-2,3-dihydro-1H-inden-1-onhydrochlorid |
| 2-[(1-Benzyl-4-piperidinyl)methyl]-5,6-dimethoxy-1-indanone hydrochloride |
| 1H-inden-1-one, 2,3-dihydro-5,6-dimethoxy-2-[[1-(phenylmethyl)-4-piperidinyl]methyl]-, hydrochloride |
| 2,3-Dihydro-5,6-dimethoxy-2-[[1-(phenylmethyl)-4-piperidinyl]methyl]-1H-inden-1-one hydrochloride |
| 1-Benzyl-4-[(5,6-dimethoxy-1-indanon-2-yl)methyl]piperidine Hydrochloride |
| Donepezil HCl |
| 2-[(1-benzylpiperidin-4-yl)methyl]-5,6-dimethoxy-2,3-dihydro-1H-inden-1-one hydrochloride |
| Donepezil hydrochloride |
| 2-[(1-Benzylpiperidin-4-yl)methyl]-5,6-dimethoxyindan-1-one hydrochloride (1:1) |
| Donepezil |