N-Boc-trans-4-amino-L-proline methyl ester structure
|
Common Name | N-Boc-trans-4-amino-L-proline methyl ester | ||
|---|---|---|---|---|
| CAS Number | 121148-00-3 | Molecular Weight | 244.288 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 320.7±42.0 °C at 760 mmHg | |
| Molecular Formula | C11H20N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.7±27.9 °C | |
| Name | 1-O-tert-butyl 2-O-methyl (2S,4R)-4-aminopyrrolidine-1,2-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 320.7±42.0 °C at 760 mmHg |
| Molecular Formula | C11H20N2O4 |
| Molecular Weight | 244.288 |
| Flash Point | 147.7±27.9 °C |
| Exact Mass | 244.142303 |
| PSA | 81.86000 |
| LogP | 0.10 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.490 |
| InChIKey | IOLQYMRFIIVPMQ-SFYZADRCSA-N |
| SMILES | COC(=O)C1CC(N)CN1C(=O)OC(C)(C)C |
| HS Code | 2933990090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| PIP002 |
| N-Boc-trans-4-amino-L-proline methyl ester |
| N-Boc-tAmp-OMe |