HPK1-IN-8 structure
|
Common Name | HPK1-IN-8 | ||
|---|---|---|---|---|
| CAS Number | 1214561-09-7 | Molecular Weight | 412.44 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H17FN6O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of HPK1-IN-8HPK1-IN-8 is an allosteric, inactive conformation-selective inhibitor of full-length HPK1. |
| Name | HPK1-IN-8 |
|---|
| Description | HPK1-IN-8 is an allosteric, inactive conformation-selective inhibitor of full-length HPK1. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C19H17FN6O2S |
|---|---|
| Molecular Weight | 412.44 |
| InChIKey | DKCQZXASVNYNLW-UHFFFAOYSA-N |
| SMILES | Cc1nc2[nH]nc(C)n2c(=O)c1CC(=O)Nc1ncc(Cc2ccccc2F)s1 |