HPK1-IN-20
Modify Date: 2025-11-28 10:11:05
HPK1-IN-20 structure
|
Common Name | HPK1-IN-20 | ||
|---|---|---|---|---|
| CAS Number | 2561490-78-4 | Molecular Weight | 456.54 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H28N6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of HPK1-IN-20HPK1-IN-19 is a hematopoietic progenitor kinase 1 (HPK1) inhibitor extracted from patent WO2020235902A1 compound 106[1]. |
| Name | HPK1-IN-20 |
|---|
| Description | HPK1-IN-19 is a hematopoietic progenitor kinase 1 (HPK1) inhibitor extracted from patent WO2020235902A1 compound 106[1]. |
|---|---|
| Related Catalog | |
| Target |
hematopoietic progenitor kinase 1 (HPK1)[1] |
| References |
[1]. Hyun JS, et, al. Heterocycle-fused pyrimidine derivative and use thereof. WO2020235902A1. |
| Molecular Formula | C26H28N6O2 |
|---|---|
| Molecular Weight | 456.54 |
| InChIKey | XBQKUZIDRVLGJV-QFIPXVFZSA-N |
| SMILES | COc1cc2c(cc1Nc1nc(N3OCCC3c3ccccc3)c3cc[nH]c3n1)CN(C)CC2 |