5-benzyloxyindole-3-acetic acid structure
|
Common Name | 5-benzyloxyindole-3-acetic acid | ||
|---|---|---|---|---|
| CAS Number | 4382-53-0 | Molecular Weight | 281.30600 | |
| Density | 1.314g/cm3 | Boiling Point | 533.2ºC at 760 mmHg | |
| Molecular Formula | C17H15NO3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 276.3ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-(5-phenylmethoxy-1H-indol-3-yl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.314g/cm3 |
|---|---|
| Boiling Point | 533.2ºC at 760 mmHg |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.30600 |
| Flash Point | 276.3ºC |
| Exact Mass | 281.10500 |
| PSA | 62.32000 |
| LogP | 3.37400 |
| Appearance of Characters | crystalline | off-white to tan |
| Index of Refraction | 1.679 |
| InChIKey | GKIOPUYLJUOZHJ-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1c[nH]c2ccc(OCc3ccccc3)cc12 |
| Storage condition | 2-8°C |
| Precursor 8 | |
|---|---|
| DownStream 4 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Effect of membrane surface potential on the uptake of anionic compounds by liposomes.
Biochim. Biophys. Acta 1192(2) , 241-6, (1994) The effect of membrane surface potential on the uptake of several anionic compounds by liposomes (large unilamellar vesicles), which contain various amounts of dipalmitoylphosphatidylserine (DPPS), wa... |
| (5-benzyloxy-indol-3-yl)-acetic acid |
| [5-(benzyloxy)-1h-indol-3-yl]acetic acid |
| 2-(5-benzyloxy-1H-indol-3-yl)acetic acid |
| B0626_ALDRICH |
| 5-benzyloxyindoleacetic acid |
| BOIAA |
| (5-Benzyloxy-indol-3-yl)-essigsaeure |
| 2-[5-(phenylmethoxy)indol-3-yl]acetic acid |
| 5-Benzyloxyindole-3-acetic acid |
| MFCD00022750 |