Fmoc-N-Me-His(Trt)-OH structure
|
Common Name | Fmoc-N-Me-His(Trt)-OH | ||
|---|---|---|---|---|
| CAS Number | 1217840-61-3 | Molecular Weight | 633.734 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 793.8±60.0 °C at 760 mmHg | |
| Molecular Formula | C41H35N3O4 | Melting Point | 183-188°C | |
| MSDS | USA | Flash Point | 433.9±32.9 °C | |
Use of Fmoc-N-Me-His(Trt)-OHFmoc-N-Me-His(Trt)-OH (Fmoc-MeHis(Trt)-OH) is a is an amino acid derivative containing amino and carboxyl groups. Fmoc-N-Me-His(Trt)-OH for the synthesis of Fmoc-MeHis (Trt) -Leu-OH[1]. |
| Name | N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N-methyl-1-trityl-L-histidine |
|---|---|
| Synonym | More Synonyms |
| Description | Fmoc-N-Me-His(Trt)-OH (Fmoc-MeHis(Trt)-OH) is a is an amino acid derivative containing amino and carboxyl groups. Fmoc-N-Me-His(Trt)-OH for the synthesis of Fmoc-MeHis (Trt) -Leu-OH[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Hisayuki T, et, al. Method for producing peptide compound. WO2020189621A1. |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 793.8±60.0 °C at 760 mmHg |
| Melting Point | 183-188°C |
| Molecular Formula | C41H35N3O4 |
| Molecular Weight | 633.734 |
| Flash Point | 433.9±32.9 °C |
| Exact Mass | 633.262756 |
| LogP | 8.52 |
| Vapour Pressure | 0.0±2.9 mmHg at 25°C |
| Index of Refraction | 1.646 |
| InChIKey | JWVLJHMKVOZWMC-LHEWISCISA-N |
| SMILES | CN(C(=O)OCC1c2ccccc2-c2ccccc21)C(Cc1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1)C(=O)O |
| RIDADR | NONH for all modes of transport |
|---|
| L-Histidine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-N-methyl-1-(triphenylmethyl)- |
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N-methyl-1-trityl-L-histidine |
| MFCD04974256 |