Fmoc-D-His(Trt)-OH structure
|
Common Name | Fmoc-D-His(Trt)-OH | ||
|---|---|---|---|---|
| CAS Number | 135610-90-1 | Molecular Weight | 619.708 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 811.7±65.0 °C at 760 mmHg | |
| Molecular Formula | C40H33N3O4 | Melting Point | 135 °C(dec.) | |
| MSDS | Chinese USA | Flash Point | 444.7±34.3 °C | |
| Name | N-Alpha-Fmoc-N-IM-Trityl-D-Histidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 811.7±65.0 °C at 760 mmHg |
| Melting Point | 135 °C(dec.) |
| Molecular Formula | C40H33N3O4 |
| Molecular Weight | 619.708 |
| Flash Point | 444.7±34.3 °C |
| Exact Mass | 619.247131 |
| PSA | 93.45000 |
| LogP | 8.03 |
| Vapour Pressure | 0.0±3.1 mmHg at 25°C |
| Index of Refraction | 1.657 |
| InChIKey | XXMYDXUIZKNHDT-DIPNUNPCSA-N |
| SMILES | O=C(NC(Cc1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| Storage condition | -20°C |
| Hazard Codes | Xi |
|---|---|
| RIDADR | NONH for all modes of transport |
|
Antioxidant activity of caffeoyl-prolyl-histidine amide and its effects on PDGF-induced proliferation of vascular smooth muscle cells.
Amino Acids 46(12) , 2777-85, (2014) Caffeic acid (CA) is one of the antioxidants found in plants, which protects vascular cells against vascular injuries from oxidative stress. In our previous study, caffeoyl-prolyl-histidine amide (CA-... |
| D-Histidine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-1-(triphenylmethyl)- |
| (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1-tritylimidazol-4-yl)propanoic acid |
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-1-trityl-D-histidine |
| Fmoc-N(im)-trityl-D-histidine |
| Fmoc-D-His(Trt)-OH |
| MFCD00077061 |