1-chloro-2,4,5-trifluoro-3-trifluoromethyl-benzene structure
|
Common Name | 1-chloro-2,4,5-trifluoro-3-trifluoromethyl-benzene | ||
|---|---|---|---|---|
| CAS Number | 122030-03-9 | Molecular Weight | 234.52600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7HClF6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-chloro-2,4,5-trifluoro-3-(trifluoromethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7HClF6 |
|---|---|
| Molecular Weight | 234.52600 |
| Exact Mass | 233.96700 |
| LogP | 3.77610 |
| Index of Refraction | 1.404 |
| InChIKey | GXUFAKYHNRIOOV-UHFFFAOYSA-N |
| SMILES | Fc1cc(Cl)c(F)c(C(F)(F)F)c1F |
| Risk Phrases | 20/21/22-36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2903999090 |
|
~50%
1-chloro-2,4,5-... CAS#:122030-03-9 |
| Literature: Krasnov, Vyacheslav I.; Vinogradov, Andrey S.; Platonov, Vyacheslav E. Mendeleev Communications, 2006 , # 3 p. 168 - 170 |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1-Chloro-2,4,5-trifluoro-3-trifluoromethyl-benzene |
| 2,5,6-trifluoro-3-chloro-benzotrifluoride |
| 5-chloro-2,3,6-trifluorobenzotrifluoride |
| 2.5.6-Trifluor-3-chlor-benzotrifluorid |
| 3-chloro-2,5,6-trifluoro-benzotrifluoride |