3-chloro-2,4,5,6-tetrafluorobenzotrifluoride structure
|
Common Name | 3-chloro-2,4,5,6-tetrafluorobenzotrifluoride | ||
|---|---|---|---|---|
| CAS Number | 4284-09-7 | Molecular Weight | 252.51700 | |
| Density | 1,7 g/cm3 | Boiling Point | 137 °C | |
| Molecular Formula | C7ClF7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 43.9ºC | |
| Name | 1-chloro-2,3,4,6-tetrafluoro-5-(trifluoromethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1,7 g/cm3 |
|---|---|
| Boiling Point | 137 °C |
| Molecular Formula | C7ClF7 |
| Molecular Weight | 252.51700 |
| Flash Point | 43.9ºC |
| Exact Mass | 251.95800 |
| LogP | 3.91520 |
| Index of Refraction | 1.391 |
| InChIKey | WFPMVEWSBGBVKV-UHFFFAOYSA-N |
| SMILES | Fc1c(F)c(Cl)c(F)c(C(F)(F)F)c1F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2903999090 |
|
~%
3-chloro-2,4,5,... CAS#:4284-09-7
Detail
|
| Literature: Russian Journal of Organic Chemistry, , vol. 40, # 8 p. 1117 - 1120 |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 3-Chloro-α,α,α,2,4,5,6-heptafluorotoluene |
| 3-Chloro-2,4,5,6-tetrafluorobenzotrifluoride |
| 3-chloro-tetra-fluorobenzotrifluoride |
| 3-chloroheptafluorotoluene |
| 1-trifluoromethyl-2,4,5,6-tetrafluoro-3-chlorobenzene |
| MFCD03094143 |
| 1-chloro-2,4,5,6-tetrafluoro-3-trifluoromethylbenzene |
| C126 |
| PC1981 |
| AC1MCSQZ |
| 2,3,4,6-tetrafluoro-5-chlorobenzotrifluoride |