1,2,3,5-tetrafluoro-4-trifluoromethyl-benzene structure
|
Common Name | 1,2,3,5-tetrafluoro-4-trifluoromethyl-benzene | ||
|---|---|---|---|---|
| CAS Number | 5360-82-7 | Molecular Weight | 218.07200 | |
| Density | 1.56g/cm3 | Boiling Point | 109-110 | |
| Molecular Formula | C7HF7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 18ºC | |
| Name | 1,2,3,5-tetrafluoro-4-(trifluoromethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.56g/cm3 |
|---|---|
| Boiling Point | 109-110 |
| Molecular Formula | C7HF7 |
| Molecular Weight | 218.07200 |
| Flash Point | 18ºC |
| Exact Mass | 217.99700 |
| LogP | 3.26180 |
| Index of Refraction | 1.3776 |
| InChIKey | TXCAZKMXLKWUTK-UHFFFAOYSA-N |
| SMILES | Fc1cc(F)c(C(F)(F)F)c(F)c1F |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 10-36/37/38 |
| Safety Phrases | 16-26-36 |
| RIDADR | UN 1993 |
| HS Code | 2903999090 |
|
~3%
1,2,3,5-tetrafl... CAS#:5360-82-7 |
| Literature: Mendeleev Communications, , # 3 p. 168 - 170 |
|
~22%
1,2,3,5-tetrafl... CAS#:5360-82-7 |
| Literature: Mendeleev Communications, , # 3 p. 168 - 170 |
|
~%
1,2,3,5-tetrafl... CAS#:5360-82-7 |
| Literature: Russian Chemical Bulletin, , vol. 46, # 4 p. 786 - 788 |
|
~%
1,2,3,5-tetrafl... CAS#:5360-82-7 |
| Literature: Russian Journal of Organic Chemistry, , vol. 44, # 1 p. 95 - 102 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 5-H-heptafluorotoluene |
| 4-trifluoromethyl-1,2,3,5-tetrafluorobenzene |
| AC1MD2JD |
| PC5451 |
| 2,3,4,6-tetrafluorbenzotrifluoride |
| 2,3,4,6-tetrafluoro-benzotrifluoride |
| CTK7B8214 |
| 1,2,3,5-Tetrafluoro-4-trifluoromethyl-benzene |
| 3h-heptafluorotoluene |
| 4-Trifluormethyl-1,2,3,5-tetrafluorbenzol |