Mivobulin structure
|
Common Name | Mivobulin | ||
|---|---|---|---|---|
| CAS Number | 122332-18-7 | Molecular Weight | 315.40700 | |
| Density | 1.36 | Boiling Point | 483ºC at 760mmHg | |
| Molecular Formula | C17H19N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 245.9ºC | |
Use of MivobulinMivobulin (NSC 613862) is a tubulin inhibitor, binds to tubulin in the region that overlaps the colchicine site, and inhibits tubulin polymerization. Mivobulin (NSC 613862) promotes the formation of abnormal polymers and a GTPase activity in the tubulin dimer. Anti-cancer activity[1]. |
| Name | ethyl N-[(2S)-5-amino-2-methyl-3-phenyl-1,2-dihydropyrido[3,4-b]pyrazin-7-yl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Description | Mivobulin (NSC 613862) is a tubulin inhibitor, binds to tubulin in the region that overlaps the colchicine site, and inhibits tubulin polymerization. Mivobulin (NSC 613862) promotes the formation of abnormal polymers and a GTPase activity in the tubulin dimer. Anti-cancer activity[1]. |
|---|---|
| Related Catalog | |
| Target |
Tubulin[1] |
| References |
| Density | 1.36 |
|---|---|
| Boiling Point | 483ºC at 760mmHg |
| Molecular Formula | C17H19N5O2 |
| Molecular Weight | 315.40700 |
| Flash Point | 245.9ºC |
| Exact Mass | 315.18300 |
| PSA | 57.61000 |
| LogP | 2.90650 |
| Vapour Pressure | 1.74E-09mmHg at 25°C |
| Index of Refraction | 1.671 |
| InChIKey | XXBDOTXPQDVHIP-JTQLQIEISA-N |
| SMILES | CCOC(=O)Nc1cc2c(c(N)n1)N=C(c1ccccc1)C(C)N2 |
| Hazard Codes | Xi |
|---|
| MIVOBULIN |
| mivobulin isethionate |
| UNII-96U5LG549X |