ajugamarin G1 structure
|
Common Name | ajugamarin G1 | ||
|---|---|---|---|---|
| CAS Number | 122587-83-1 | Molecular Weight | 632.73800 | |
| Density | 1.21g/cm3 | Boiling Point | 691.1ºC at 760mmHg | |
| Molecular Formula | C34H48O11 | Melting Point | 165-167 ºC (ethanol ) | |
| MSDS | N/A | Flash Point | 282.7ºC | |
| Name | ajugamarin G1 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 691.1ºC at 760mmHg |
| Melting Point | 165-167 ºC (ethanol ) |
| Molecular Formula | C34H48O11 |
| Molecular Weight | 632.73800 |
| Flash Point | 282.7ºC |
| Exact Mass | 632.32000 |
| PSA | 144.03000 |
| LogP | 4.40190 |
| Vapour Pressure | 5.97E-19mmHg at 25°C |
| Index of Refraction | 1.534 |
| InChIKey | JTNPKPFJZRMAJE-FKSBINAYSA-N |
| SMILES | CC=C(C)C(=O)OC1CCC2(CO2)C2(COC(C)=O)C(OC(C)=O)CC(C)C(C)(CC(OC(=O)C(C)CC)C3=CC(=O)OC3)C12 |
| Water Solubility | Practically insoluble (0.037 g/L) (25 ºC) |
|
~%
ajugamarin G1 CAS#:122587-83-1 |
| Literature: Shimomura, Hiroko; Sashida, Yutaka; Ogawa, Kazunori Chemical and Pharmaceutical Bulletin, 1989 , vol. 37, # 4 p. 996 - 998 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Butanoic acid,2-methyl-,2-(8-(acetyloxy)-8a-((acetyloxy)methyl)octahydro-5,6-dimethylspiro(naphthalene-1(2H),2'-oxiran)-5-yl)-1-(2,5-dihydro-5-oxo-3-furanyl)ethyl ester,(1R-(1alpha,4abeta,5beta(S*(S*)),6alpha,8alpha,8aalpha)) |
| Ajugamarin F 4 |
| [(1S)-2-[(1S,2R,4S,4aR,8R,8aR)-4-acetyloxy-4a-(acetyloxymethyl)-1,2-dimethyl-8-[(E)-2-methylbut-2-enoyl]oxyspiro[3,4,6,7,8,8a-hexahydro-2H-naphthalene-5,2'-oxirane]-1-yl]-1-(5-oxo-2H-furan-3-yl)ethyl] (2S)-2-methylbutanoate |