JAK-STAT-IN-1 structure
|
Common Name | JAK-STAT-IN-1 | ||
|---|---|---|---|---|
| CAS Number | 1236666-76-4 | Molecular Weight | 375.42 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H21N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of JAK-STAT-IN-1JAK-STAT-IN-1 (compound 1) is a selective JAK-STAT inhibitor. JAK-STAT-IN-1 can be used for the research of autoimmune disorder[1]. |
| Name | JAK-STAT-IN-1 |
|---|
| Description | JAK-STAT-IN-1 (compound 1) is a selective JAK-STAT inhibitor. JAK-STAT-IN-1 can be used for the research of autoimmune disorder[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C21H21N5O2 |
|---|---|
| Molecular Weight | 375.42 |
| InChIKey | OQGHGKFTKWEBSK-UHFFFAOYSA-N |
| SMILES | Cc1cnc(Nc2cc(C)c(C)c(C)c2)nc1Nc1ccc2oc(=O)[nH]c2c1 |