Retusin structure
|
Common Name | Retusin | ||
|---|---|---|---|---|
| CAS Number | 1245-15-4 | Molecular Weight | 358.34200 | |
| Density | 1.36g/cm3 | Boiling Point | 569.2ºC at 760mmHg | |
| Molecular Formula | C19H18O7 | Melting Point | 156-161ºC | |
| MSDS | N/A | Flash Point | 205.6ºC | |
Use of RetusinRetusin (Quercetin-3,3',4',7-tetramethylether), a natural compound isolated from the leaves of Talinum triangulare, possesses antiviral and anti-inflammatory activities[1]. |
| Name | quercetin-3,7,3',4'-tetramethyl ether |
|---|---|
| Synonym | More Synonyms |
| Description | Retusin (Quercetin-3,3',4',7-tetramethylether), a natural compound isolated from the leaves of Talinum triangulare, possesses antiviral and anti-inflammatory activities[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 569.2ºC at 760mmHg |
| Melting Point | 156-161ºC |
| Molecular Formula | C19H18O7 |
| Molecular Weight | 358.34200 |
| Flash Point | 205.6ºC |
| Exact Mass | 358.10500 |
| PSA | 87.36000 |
| LogP | 3.20000 |
| Vapour Pressure | 1.48E-13mmHg at 25°C |
| Index of Refraction | 1.617 |
| InChIKey | HHGPYJLEJGNWJA-UHFFFAOYSA-N |
| SMILES | COc1cc(O)c2c(=O)c(OC)c(-c3ccc(OC)c(OC)c3)oc2c1 |
| HS Code | 2914509090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 4 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Name: In vitro cytotoxic potency against NCI-60 human tumor cell line
Source: ChEMBL
Target: Panel NCI-60 (60 carcinoma cell lines)
External Id: CHEMBL749609
|
|
Name: Anticancer activity against human NCI-H1792 cells by HTS assay
Source: ChEMBL
Target: NCI-H1792
External Id: CHEMBL3380564
|
|
Name: Anticancer activity against human NCI-H1944 cells by HTS assay
Source: ChEMBL
Target: NON-PROTEIN TARGET
External Id: CHEMBL3380565
|
|
Name: Anticancer activity against human NCI-H157 cells by HTS assay
Source: ChEMBL
Target: NCI-H157
External Id: CHEMBL3380562
|
|
Name: Anticancer activity against human H460 cells by HTS assay
Source: ChEMBL
Target: NON-PROTEIN TARGET
External Id: CHEMBL3380563
|
|
Name: Cytotoxicity against human A2780 cells assessed as intracellular ATP level at 10 uM a...
Source: ChEMBL
Target: A2780
External Id: CHEMBL1685111
|
|
Name: Anticancer activity against human HOP62 cells by HTS assay
Source: ChEMBL
Target: HOP-62
External Id: CHEMBL3380568
|
|
Name: Cytotoxicity against human MCF7 cells assessed as intracellular ATP level at 10 uM af...
Source: ChEMBL
Target: MCF7
External Id: CHEMBL1685112
|
|
Name: Anticancer activity against human H1299 cells by HTS assay
Source: ChEMBL
Target: NON-PROTEIN TARGET
External Id: CHEMBL3380569
|
|
Name: Anticancer activity against human H266 cells by HTS assay
Source: ChEMBL
Target: NON-PROTEIN TARGET
External Id: CHEMBL3380566
|
| RETUSIN |
| Einecs 214-991-4 |
| 5-Hydroxy-3,3',4',7-tetramethoxyflavone |
| 3,3',4',7-tetramethoxy-5-hydroxyflavone |
| QUERCETINTETRAMETHYLETHER |
| 3,7,3',4'-Tetra-O-methylquercetin |
| 3,7,3',4'-Tetra-O-methylguercetin |