(4R-Cis)-6-Hydroxymethyl-2,2-dimethyl-1,3-dioxane-4-acetic acid 1,1-dimethylethyl ester structure
|
Common Name | (4R-Cis)-6-Hydroxymethyl-2,2-dimethyl-1,3-dioxane-4-acetic acid 1,1-dimethylethyl ester | ||
|---|---|---|---|---|
| CAS Number | 124655-09-0 | Molecular Weight | 260.327 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 330.9±17.0 °C at 760 mmHg | |
| Molecular Formula | C13H24O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 113.1±14.4 °C | |
| Name | (4R-Cis)-6-Hydroxymethyl-2,2-Dimethyl-1,3-Dioxane-4-Acetic Acid 1,1-Dimethylethyl Ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 330.9±17.0 °C at 760 mmHg |
| Molecular Formula | C13H24O5 |
| Molecular Weight | 260.327 |
| Flash Point | 113.1±14.4 °C |
| Exact Mass | 260.162384 |
| PSA | 64.99000 |
| LogP | 1.64 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.442 |
| InChIKey | CFRUAOXMCVQMFP-ZJUUUORDSA-N |
| SMILES | CC(C)(C)OC(=O)CC1CC(CO)OC(C)(C)O1 |
| Storage condition | -20°C Freezer |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2932999099 |
| Precursor 5 | |
|---|---|
| DownStream 6 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Methyl-2-propanyl 2,4-dideoxy-3,5-O-isopropylidene-D-erythro-hexonate |
| 1,1-Dimethylethyl 2,4-dideoxy-3,5-O-(1-methylethylidene)-D-erythro-hexonoate |
| (4R,6S)-6-(Hydroxymethyl)-2,2-dimethyl-1,3-dioxane-4-acetic Acid tert-Butyl Ester |
| 2-[(4R,6S)-6-(Hydroxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetic Acid tert-Butyl Ester |
| tert-Butyl 2,4-dideoxy-3,5-O-isopropylidene-D-erythro-hexonate |
| D-erythro-Hexonic acid, 2,4-dideoxy-3,5-O-(1-methylethylidene)-, 1,1-dimethylethyl ester |
| tert-Butyl (3R,5S)-6-hydroxy-3,5-O-isopropylidene-3,5-dihydroxyhexanoate |
| (4R-cis)-6-Hydroxymethyl-2,2-dimethyl-1,3-dioxane-4-acetic acid, 1,1-dimethylethyl Ester |
| tert-butyl 2,4-dideoxy-3,5-O-(1-methylethylidene)-D-erythro-hexonate |
| tert-butyl 2-[(4R,6S)-6-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
| EINECS 432-960-5 |
| (4R,6S)-6-Hydroxymethyl-2,2-dimethyl-1,3-dioxane-4-acetic Acid 1,1-Dimethylethyl Ester |
| tert-Butyl [(4R,6S)-6-hydroxymethyl-1,3-dioxan-4-yl]acetate |
| T6O COTJ B1 B1 D1VOX1&1&1 F1Q &&D-Erythro or (4R,6S)- Form |
| tert-Butyl (4R,6S)-6-(Hydroxymethyl)-2,2-dimethyl-1,3-dioxane-4-acetate |
| MFCD08063915 |