(4R-Cis)-6-[(acetyloxy)methyl]-2,2-dimethyl-1,3-dioxane-4-aceticacid,1,1-dimethylethylester structure
|
Common Name | (4R-Cis)-6-[(acetyloxy)methyl]-2,2-dimethyl-1,3-dioxane-4-aceticacid,1,1-dimethylethylester | ||
|---|---|---|---|---|
| CAS Number | 154026-95-6 | Molecular Weight | 302.363 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 353.1±22.0 °C at 760 mmHg | |
| Molecular Formula | C15H26O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.3±22.4 °C | |
| Name | tert-Butyl (4R-cis)-6-[(acetyloxy)methyl]-2,2-dimethyl-1,3-dioxane-4-acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 353.1±22.0 °C at 760 mmHg |
| Molecular Formula | C15H26O6 |
| Molecular Weight | 302.363 |
| Flash Point | 150.3±22.4 °C |
| Exact Mass | 302.172943 |
| PSA | 71.06000 |
| LogP | 2.18 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.436 |
| InChIKey | NGABCYSYENPREI-NEPJUHHUSA-N |
| SMILES | CC(=O)OCC1CC(CC(=O)OC(C)(C)C)OC(C)(C)O1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2932999099 |
|
~78%
(4R-Cis)-6-[(ac... CAS#:154026-95-6 |
| Literature: DSM IP ASSESTS B.V. Patent: WO2003/106447 A1, 2003 ; Location in patent: Page 5 ; |
|
~99%
(4R-Cis)-6-[(ac... CAS#:154026-95-6 |
| Literature: BAKHU PHARMA LIMITED; PROCTOR, Lee David; GREIG, Stuart Alexander James Patent: WO2012/17242 A1, 2012 ; Location in patent: Page/Page column 20 ; |
|
~%
(4R-Cis)-6-[(ac... CAS#:154026-95-6 |
| Literature: WO2012/17242 A1, ; Page/Page column 14 ; |
|
~%
(4R-Cis)-6-[(ac... CAS#:154026-95-6 |
| Literature: Fan, Weizheng; Li, Wanfang; Ma, Xin; Tao, Xiaoming; Li, Xiaoming; Yao, Ying; Xie, Xiaomin; Zhang, Zhaoguo Journal of Organic Chemistry, 2011 , vol. 76, # 22 p. 9444 - 9451 |
|
~%
(4R-Cis)-6-[(ac... CAS#:154026-95-6 |
| Literature: WO2012/17242 A1, ; Page/Page column 11-12 ; |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (4R,6S)-6-[(acetyloxy)methyl]-2,2-dimethyl-1,3-dioxane-4-acetic acid |
| tert-butyl 6-O-acetyl-2,4-dideoxy-3,5-O-(1-methylethylidene)-D-erythro-hexonate |
| tert-Butyl (4R-cis) |
| 6S)-6-(acetoxyMethyl)-2 |
| (4R-CIS)-6-[ (ACETYLOXY)METHYL ]-2,2-DIMETHYL-1 |
| 1,1-dimethylethylester |
| D-erythro-Hexonic acid, 2,4-dideoxy-3,5-O-(1-methylethylidene)-, 1,1-dimethylethyl ester, acetate |
| MFCD08458213 |
| tert-butyl 2-[(4R,6S)-6-(acetoxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
| tert-Butyl(4R-cis)-6-[(acetyloxy)methyl]-2,2-dimethyl-1,3-dioxane-4-acetate |
| tert-Butyl 6-O-acetyl-2,4-dideoxy-3,5-O-isopropylidene-D-erythro-hexonate |
| tert-butyl 2-((4R |
| 3-dioxan-4-yl)acetate |
| (4R-cis)-6-[(acetyloxy)methyl]-2,2-dimethyl-1,3-dioxane-4-acetic acid,1,1-dimethylethyl ester |
| 2-Methyl-2-propanyl 6-O-acetyl-2,4-dideoxy-3,5-O-isopropylidene-D-erythro-hexonate |
| (4R-CIS)-6-[(ACETYLOXY)METHYL]-2,2-DIMETHYL-1,3-DIOXANE-4-ACETIC ACID,T-BUTYL ESTER |
| rosuvastatin interMediates D-5 |
| tert-butyl 2-{(4R,6S)-2,2-dimethyl-6-[(methyl-carbonyloxy)methyl]-1,3-dioxan-4-yl} acetate |
| 2-[(4R,6S)-6-(Acetoxymethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid tert-buthyl ester |
| (4R-Cis)-6-[(acetyloxy)methyl]-2,2-dimethyl-1,3-dioxane-4-aceticacid,1,1-dimethylethylester |