SRI 62320 structure
|
Common Name | SRI 62320 | ||
|---|---|---|---|---|
| CAS Number | 94061-80-0 | Molecular Weight | 433.45 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H25FNNaO4 | Melting Point | N/A | |
| MSDS | Chinese | Flash Point | N/A | |
Use of SRI 62320(3R,5S)-Fluvastatin ((3R,5S)-XU 62-320) sodium is the 3R,5S-isomer Fluvastatin. Fluvastatin (XU 62-320 free acid) is a first fully synthetic, competitive HMG-CoA reductase inhibitor with an IC50 of 8 nM. Fluvastatin protects vascular smooth muscle cells against oxidative stress through the Nrf2-dependent antioxidant pathway[1][2][3]. |
| Name | sodium,(E,3R,5S)-7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3,5-dihydroxyhept-6-enoate |
|---|---|
| Synonym | More Synonyms |
| Description | (3R,5S)-Fluvastatin ((3R,5S)-XU 62-320) sodium is the 3R,5S-isomer Fluvastatin. Fluvastatin (XU 62-320 free acid) is a first fully synthetic, competitive HMG-CoA reductase inhibitor with an IC50 of 8 nM. Fluvastatin protects vascular smooth muscle cells against oxidative stress through the Nrf2-dependent antioxidant pathway[1][2][3]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C24H25FNNaO4 |
|---|---|
| Molecular Weight | 433.45 |
| Exact Mass | 433.16700 |
| PSA | 85.52000 |
| LogP | 3.29340 |
| InChIKey | ZGGHKIMDNBDHJB-NRFPMOEYSA-M |
| SMILES | CC(C)n1c(C=CC(O)CC(O)CC(=O)[O-])c(-c2ccc(F)cc2)c2ccccc21.[Na+] |
| (3R,5S)-7-(3-(4-fluorophenyl)-1-(1-methylethyl)-1H-indol-2-yl)-3,5-dihydroxy-6-heptenoic acid monosodium salt |
| Canef |
| FLUVASTATIN SODIUM |
| (+)-(3R,5S)-fluvastatin sodium |
| (3R,5S,E)-7-(3-(4-fluorophenyl)-1-isopropyl-1H-indol-2-yl)-3,5-dihydroxyhept-6-enoic acid sodium salt |
| XU-62-320 |
| Lescol |
| fluindostatin |
| (E)-(3R,5S)-(+)-7-[3-(4-fluoro-phenyl)-1-isopropyl-1H-indol-2-yl]-3,5-dihydroxy-hept-6-enoic acid sodium salt |
| erythro-(E)-3R,5S-7-[3-(4-fluorophenyl)-1-(1-methylethyl)-1H-indol-2-yl]-3,5-dihydroxy-6-heptenoic acid,sodium salt |