Vincristine-d3 sulfate structure
|
Common Name | Vincristine-d3 sulfate | ||
|---|---|---|---|---|
| CAS Number | 1246817-10-6 | Molecular Weight | 926.05 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C46H55D3N4O14S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Vincristine-d3 sulfateVincristine-d3 (Leurocristine-d3) sulfate is the deuterium labeled Vincristine sulfate. Vincristine sulfate is an antitumor vinca alkaloid which inhibits microtubule formation in mitotic spindle, resulting in an arrest of dividing cells at the metaphase stage. It binds to microtubule with a Ki of 85 nM[1][2]. |
| Name | Vincristine-d3 sulfate |
|---|
| Description | Vincristine-d3 (Leurocristine-d3) sulfate is the deuterium labeled Vincristine sulfate. Vincristine sulfate is an antitumor vinca alkaloid which inhibits microtubule formation in mitotic spindle, resulting in an arrest of dividing cells at the metaphase stage. It binds to microtubule with a Ki of 85 nM[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
[3]. Gidding, C.E., et al, Vincristine revisited. Crit Rev Oncol Hematol, 1999. 29(3): p. 267-87. |
| Molecular Formula | C46H55D3N4O14S |
|---|---|
| Molecular Weight | 926.05 |
| InChIKey | AQTQHPDCURKLKT-REHGKODJSA-N |
| SMILES | CCC1(O)CC2CN(CCc3c([nH]c4ccccc34)C(C(=O)OC)(c3cc4c(cc3OC)N(C=O)C3C(O)(C(=O)OC)C(OC(C)=O)C5(CC)C=CCN6CCC43C65)C2)C1.O=S(=O)(O)O |