Propiconazole-d7 structure
|
Common Name | Propiconazole-d7 | ||
|---|---|---|---|---|
| CAS Number | 1246818-14-3 | Molecular Weight | 349.263 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 480.0±55.0 °C at 760 mmHg | |
| Molecular Formula | C15H10D7Cl2N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244.1±31.5 °C | |
Use of Propiconazole-d7Propiconazole-d7 is the deuterium labeled Propiconazole. Propiconazole is a broad-spectrum triazole fungicide that inhibits the conversion of lanosterol to ergosterol, leading to fungal cell membrane disruption. Propiconazole inhibits S. cerevisiae, but not rat liver, microsomal cytochrome P450 (IC50s=0.04 and >200 µM, respectively). Propiconazole inhibits the growth of T. deformans and R. stolonifer (ED50s=0.073 and 4.6 µg/mL, respectively). Propiconazole increases production of reactive oxygen species (ROS)[1]. |
| Name | Propiconazole-d7 |
|---|---|
| Synonym | More Synonyms |
| Description | Propiconazole-d7 is the deuterium labeled Propiconazole. Propiconazole is a broad-spectrum triazole fungicide that inhibits the conversion of lanosterol to ergosterol, leading to fungal cell membrane disruption. Propiconazole inhibits S. cerevisiae, but not rat liver, microsomal cytochrome P450 (IC50s=0.04 and >200 µM, respectively). Propiconazole inhibits the growth of T. deformans and R. stolonifer (ED50s=0.073 and 4.6 µg/mL, respectively). Propiconazole increases production of reactive oxygen species (ROS)[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 480.0±55.0 °C at 760 mmHg |
| Molecular Formula | C15H10D7Cl2N3O2 |
| Molecular Weight | 349.263 |
| Flash Point | 244.1±31.5 °C |
| Exact Mass | 348.113708 |
| LogP | 3.88 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.624 |
| InChIKey | STJLVHWMYQXCPB-ZBJDZAJPSA-N |
| SMILES | CCCC1COC(Cn2cncn2)(c2ccc(Cl)cc2Cl)O1 |
| Propiconazole-d7 |
| 1-{[2-(2,4-Dichlorophenyl)-4-(2H7)propyl-1,3-dioxolan-2-yl]methyl}-1H-1,2,4-triazole |
| 1H-1,2,4-Triazole, 1-[[2-(2,4-dichlorophenyl)-4-(propyl-d7)-1,3-dioxolan-2-yl]methyl]- |