Cimbuterol-D9 structure
|
Common Name | Cimbuterol-D9 | ||
|---|---|---|---|---|
| CAS Number | 1246819-04-4 | Molecular Weight | 242.36500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10D9N3O | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of Cimbuterol-D9Cimbuterol-D9 is the deuterium labeled Cimbuterol. Cimbuterol is aβ-adrenergic agonist[1]. |
| Name | 2-amino-5-[2-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]-1-hydroxyethyl]benzonitrile |
|---|---|
| Synonym | More Synonyms |
| Description | Cimbuterol-D9 is the deuterium labeled Cimbuterol. Cimbuterol is aβ-adrenergic agonist[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C13H10D9N3O |
|---|---|
| Molecular Weight | 242.36500 |
| Exact Mass | 242.20900 |
| PSA | 82.07000 |
| LogP | 2.53408 |
| InChIKey | YKKQAXQGZIBJFS-GQALSZNTSA-N |
| SMILES | CC(C)(C)NCC(O)c1ccc(N)c(C#N)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Hazard Codes | Xn |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26 |
| RIDADR | NONH for all modes of transport |
| 2-Amino-5-(2-tert-butyl-d9-amino-1-hydroxyethyl)benzonitrile |
| Cimbuterol-d9 |
| 2-Amino-5-[2-[(1,1-dimethylethyl-d9)amino]-1-hydroxyethyl]benzonitrile |
| Cimbuterol-(tert-butyl-d9) |