Ganirelix
Modify Date: 2025-08-25 10:50:06
Ganirelix structure
|
Common Name | Ganirelix | ||
|---|---|---|---|---|
| CAS Number | 124904-93-4 | Molecular Weight | 1570.32000 | |
| Density | 1.31 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C80H113ClN18O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of GanirelixGanirelix is a competitive and selective gonadotropin releasing hormone (GnRH) antagonist. Ganirelix prevents endogenous GnRH from inducing luteinising hormone (LH) and follicle stimulating hormone relea[1]. |
| Name | ganirelix |
|---|
| Description | Ganirelix is a competitive and selective gonadotropin releasing hormone (GnRH) antagonist. Ganirelix prevents endogenous GnRH from inducing luteinising hormone (LH) and follicle stimulating hormone relea[1]. |
|---|---|
| Related Catalog | |
| In Vivo | Ganirelix (0.1 mg/kg; s.c.; daily for 14 d) reduces luteinising hormone levels in female rats[2]. Animal Model: Female Sprague-Dawley rats, weighing 225–300 mg[2] Dosage: 0.1 mg/kg Administration: Subcutaneous injection, daily for 14 d Result: Reduced luteinising hormone levels. |
| References |
[1]. Gillies PS, et al. Ganirelix. Drugs. 2000 Jan;59(1):107-11; discussion 112-3. |
| Density | 1.31 g/cm3 |
|---|---|
| Molecular Formula | C80H113ClN18O13 |
| Molecular Weight | 1570.32000 |
| Exact Mass | 1568.84000 |
| PSA | 451.49000 |
| LogP | 7.99260 |
| InChIKey | GJNXBNATEDXMAK-PFLSVRRQSA-N |
| SMILES | CCNC(=NCCCCC(NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(CO)NC(=O)C(Cc1cccnc1)NC(=O)C(Cc1ccc(Cl)cc1)NC(=O)C(Cc1ccc2ccccc2c1)NC(C)=O)C(=O)NC(CC(C)C)C(=O)NC(CCCCN=C(NCC)NCC)C(=O)N1CCCC1C(=O)NC(C)C(N)=O)NCC |