Aza197 structure
|
Common Name | Aza197 | ||
|---|---|---|---|---|
| CAS Number | 1249398-09-1 | Molecular Weight | 408.58 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H36N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Aza197AZA197 is a selective small molecule inhibitor of Cdc42.AZA197 suppresses colon cancer cell proliferation, cell migration, invasion and increases apoptosis by down-regulating the PAK1 and ERK signaling pathways in vitro. AZA197 reduces tumor growth and significantly increases mouse survival in SW620 tumor xenografts[1]. |
| Name | AZA197 |
|---|
| Description | AZA197 is a selective small molecule inhibitor of Cdc42.AZA197 suppresses colon cancer cell proliferation, cell migration, invasion and increases apoptosis by down-regulating the PAK1 and ERK signaling pathways in vitro. AZA197 reduces tumor growth and significantly increases mouse survival in SW620 tumor xenografts[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C24H36N6 |
|---|---|
| Molecular Weight | 408.58 |
| InChIKey | SUXUDORZKKZLJK-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCCC(C)Nc1nc(C)cc(NCCc2c[nH]c3ccccc23)n1 |