Hexamethylquercetagetin structure
|
Common Name | Hexamethylquercetagetin | ||
|---|---|---|---|---|
| CAS Number | 1251-84-9 | Molecular Weight | 402.39500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H22O8 | Melting Point | 142-144 °C | |
| MSDS | N/A | Flash Point | N/A | |
Use of HexamethylquercetagetinHexamethylquercetagetin is a polymethoxylated flavone in peels of citrus cultivars. |
| Name | quercetagetin hexamethyl ether |
|---|---|
| Synonym | More Synonyms |
| Description | Hexamethylquercetagetin is a polymethoxylated flavone in peels of citrus cultivars. |
|---|---|
| Related Catalog | |
| References |
| Melting Point | 142-144 °C |
|---|---|
| Molecular Formula | C21H22O8 |
| Molecular Weight | 402.39500 |
| Exact Mass | 402.13100 |
| PSA | 85.59000 |
| LogP | 3.51160 |
| Vapour Pressure | 1.91E-13mmHg at 25°C |
| InChIKey | CHXSDKWBSFDZEU-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2oc3cc(OC)c(OC)c(OC)c3c(=O)c2OC)cc1OC |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914509090 |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 3,5,6,7,3',4'-pentamethoxyflavone |
| quercetogetin |
| quercetagetin 3,5,6,7,3',4'-hexamethyl ether |
| gossypetin hexamethyl ether |
| 3,3',4',5,6,7-hexamethoxyflavone |
| 3,5,6,7,3',4'-hexamethoxyflavone |