Salvigenin structure
|
Common Name | Salvigenin | ||
|---|---|---|---|---|
| CAS Number | 19103-54-9 | Molecular Weight | 328.316 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 535.9±50.0 °C at 760 mmHg | |
| Molecular Formula | C18H16O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.9±23.6 °C | |
Use of SalvigeninSalvigenin is a natural polyphenolic compound, with neuroprotective effect. Salvigenin has antitumor cytotoxic and immunomodulatory properties[1][2]. |
| Name | 5-hydroxy-6,7-dimethoxy-2-(4-methoxyphenyl)chromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | Salvigenin is a natural polyphenolic compound, with neuroprotective effect. Salvigenin has antitumor cytotoxic and immunomodulatory properties[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 535.9±50.0 °C at 760 mmHg |
| Molecular Formula | C18H16O6 |
| Molecular Weight | 328.316 |
| Flash Point | 196.9±23.6 °C |
| Exact Mass | 328.094696 |
| PSA | 78.13000 |
| LogP | 3.01 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.606 |
| InChIKey | QCDYOIZVELGOLZ-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2cc(=O)c3c(O)c(OC)c(OC)cc3o2)cc1 |
| Storage condition | 2-8℃ |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914509090 |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 5-Hydroxy-6,7,4'-trimethoxyflavone |
| 5-Hydroxy-6,7-dimethoxy-2-(4-methoxyphenyl)-4H-chromen-4-one |
| salvigenin |
| 5-Hydroxy-6,7-dimethoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one |
| 5-Hydroxy-4',6,7-trimethoxyflavone |
| Psathyrotin |
| 5-hydroxyl-4',6,7-trimethoxylflavone |
| 4H-1-Benzopyran-4-one, 5-hydroxy-6,7-dimethoxy-2-(4-methoxyphenyl)- |
| 6,7,4'-trimethylscutellarein |