2,6-dimethyl-4-(2-(4-fluorophenyl)ethenyl)phenol structure
|
Common Name | 2,6-dimethyl-4-(2-(4-fluorophenyl)ethenyl)phenol | ||
|---|---|---|---|---|
| CAS Number | 125722-16-9 | Molecular Weight | 242.28800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15FO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 2,6-dimethyl-4-(2-(4-fluorophenyl)ethenyl)phenolEnofelast (BI-L-239), a 5-lipoxygenase (5-LO) inhibitor, exhibits an IC50 of 2.48 μM for inhibition of calcium ionophore-induced LTB4 generation[1]. |
| Name | 4-[2-(4-fluorophenyl)ethenyl]-2,6-dimethylphenol |
|---|---|
| Synonym | More Synonyms |
| Description | Enofelast (BI-L-239), a 5-lipoxygenase (5-LO) inhibitor, exhibits an IC50 of 2.48 μM for inhibition of calcium ionophore-induced LTB4 generation[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50: 2.48 μM (LTB4)[1]. |
| References |
| Molecular Formula | C16H15FO |
|---|---|
| Molecular Weight | 242.28800 |
| Exact Mass | 242.11100 |
| PSA | 20.23000 |
| LogP | 4.31850 |
| Vapour Pressure | 1.79E-05mmHg at 25°C |
| InChIKey | HJGJDFXTHQBVNV-ONEGZZNKSA-N |
| SMILES | Cc1cc(C=Cc2ccc(F)cc2)cc(C)c1O |
| 2,6-Dimethyl-4-(2-(4-fluorophenyl)ethenyl)phenol |