4-(dichloro(4-(dimethylamino)phenyl)methyl)-N,N-dimethylbenzenamine structure
|
Common Name | 4-(dichloro(4-(dimethylamino)phenyl)methyl)-N,N-dimethylbenzenamine | ||
|---|---|---|---|---|
| CAS Number | 6483-79-0 | Molecular Weight | 323.26000 | |
| Density | 1.217g/cm3 | Boiling Point | 565.6ºC at 760 mmHg | |
| Molecular Formula | C17H20Cl2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 295.8ºC | |
| Name | 4-[dichloro-[4-(dimethylamino)phenyl]methyl]-N,N-dimethylaniline |
|---|
| Density | 1.217g/cm3 |
|---|---|
| Boiling Point | 565.6ºC at 760 mmHg |
| Molecular Formula | C17H20Cl2N2 |
| Molecular Weight | 323.26000 |
| Flash Point | 295.8ºC |
| Exact Mass | 322.10000 |
| PSA | 6.48000 |
| LogP | 4.49730 |
| Index of Refraction | 1.619 |
| InChIKey | BNMFGJCZGFYTCI-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(C(Cl)(Cl)c2ccc(N(C)C)cc2)cc1 |
| HS Code | 2921590090 |
|---|
|
~%
4-(dichloro(4-(... CAS#:6483-79-0 |
| Literature: Conant; Bigelow Journal of the American Chemical Society, 1931 , vol. 53, p. 676,688 |
|
~%
4-(dichloro(4-(... CAS#:6483-79-0 |
| Literature: Staudinger Chemische Berichte, 1909 , vol. 42, p. 3976 |
|
~%
4-(dichloro(4-(... CAS#:6483-79-0 |
| Literature: Staudinger Chemische Berichte, 1909 , vol. 42, p. 3976 |
|
~%
4-(dichloro(4-(... CAS#:6483-79-0 |
| Literature: Staudinger Chemische Berichte, 1909 , vol. 42, p. 3976 |
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |