Sulfadoxine D3 structure
|
Common Name | Sulfadoxine D3 | ||
|---|---|---|---|---|
| CAS Number | 1262770-70-6 | Molecular Weight | 313.34700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11D3N4O4S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of Sulfadoxine D3Sulfadoxine D3 is a deuterium labeled Sulfadoxine. Sulfadoxine is a long acting sulfonamide that is used, usually in combination with other drugs, for respiratory, urinary tract and malarial infections. Sulfadoxine inhibits HIV replication in peripheral blood mononuclear cells. |
| Name | 4-amino-N-[5-methoxy-6-(trideuteriomethoxy)pyrimidin-4-yl]benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Description | Sulfadoxine D3 is a deuterium labeled Sulfadoxine. Sulfadoxine is a long acting sulfonamide that is used, usually in combination with other drugs, for respiratory, urinary tract and malarial infections. Sulfadoxine inhibits HIV replication in peripheral blood mononuclear cells. |
|---|---|
| Related Catalog |
| Molecular Formula | C12H11D3N4O4S |
|---|---|
| Molecular Weight | 313.34700 |
| Exact Mass | 313.09200 |
| PSA | 124.81000 |
| LogP | 2.61180 |
| InChIKey | PJSFRIWCGOHTNF-BMSJAHLVSA-N |
| SMILES | COc1ncnc(NS(=O)(=O)c2ccc(N)cc2)c1OC |
| Storage condition | -20°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26 |
| RIDADR | NONH for all modes of transport |
| Sulfadoxine-d3 |