endo-BCN-O-PNB structure
|
Common Name | endo-BCN-O-PNB | ||
|---|---|---|---|---|
| CAS Number | 1263166-91-1 | Molecular Weight | 315.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H17NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of endo-BCN-O-PNBendo-BCN-O-PNB is an alkyl/ether-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | endo-BCN-O-PNB |
|---|---|
| Synonym | More Synonyms |
| Description | endo-BCN-O-PNB is an alkyl/ether-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1] |
| References |
| Molecular Formula | C17H17NO5 |
|---|---|
| Molecular Weight | 315.32 |
| InChIKey | QXNXOXMDBLHIDB-XYPWUTKMSA-N |
| SMILES | O=C(OCC1C2CCC#CCCC21)Oc1ccc([N+](=O)[O-])cc1 |
| MFCD19705415 |