fasciculic acid B structure
|
Common Name | fasciculic acid B | ||
|---|---|---|---|---|
| CAS Number | 126882-55-1 | Molecular Weight | 636.85600 | |
| Density | 1.21g/cm3 | Boiling Point | 767.6ºC at 760mmHg | |
| Molecular Formula | C36H60O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.2ºC | |
Use of fasciculic acid BFasciculic acid B is a steroid that can be isolated from Hypholoma lateritium. Fasciculic acid B has antiinflammatory and calmodulin antagonistic activity[1][2]. |
| Name | 5-[[(2R,3R,10S,12S,13R,14S,17R)-17-[(2R,5R)-5,6-dihydroxy-6-methylheptan-2-yl]-3,12-dihydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-2-yl]oxy]-3-hydroxy-3-methyl-5-oxopentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Fasciculic acid B is a steroid that can be isolated from Hypholoma lateritium. Fasciculic acid B has antiinflammatory and calmodulin antagonistic activity[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 767.6ºC at 760mmHg |
| Molecular Formula | C36H60O9 |
| Molecular Weight | 636.85600 |
| Flash Point | 231.2ºC |
| Exact Mass | 636.42400 |
| PSA | 164.75000 |
| LogP | 4.75300 |
| Vapour Pressure | 3.33E-27mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | SWRXIGFQDQTNKP-RAOJVCEKSA-N |
| SMILES | CC(CCC(O)C(C)(C)O)C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(OC(=O)CC(C)(O)CC(=O)O)C(O)C(C)(C)C1CC3 |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| Fasciculic acid B |