fasciculic acid A structure
|
Common Name | fasciculic acid A | ||
|---|---|---|---|---|
| CAS Number | 126906-00-1 | Molecular Weight | 620.85700 | |
| Density | 1.18g/cm3 | Boiling Point | 738.7ºC at 760mmHg | |
| Molecular Formula | C36H60O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.6ºC | |
Use of fasciculic acid AFasciculic acid A is a steroid that can be isolated from Hypholoma lateritium. Fasciculic acid B has antiinflammatory and calmodulin antagonistic activity[1]. |
| Name | 5-[[(2R,3S,10S,13R,14R,17R)-17-[(2R,5R)-5,6-dihydroxy-6-methylheptan-2-yl]-3-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-2-yl]oxy]-3-hydroxy-3-methyl-5-oxopentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Fasciculic acid A is a steroid that can be isolated from Hypholoma lateritium. Fasciculic acid B has antiinflammatory and calmodulin antagonistic activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 738.7ºC at 760mmHg |
| Molecular Formula | C36H60O8 |
| Molecular Weight | 620.85700 |
| Flash Point | 221.6ºC |
| Exact Mass | 620.42900 |
| PSA | 144.52000 |
| LogP | 5.78220 |
| Vapour Pressure | 3.43E-25mmHg at 25°C |
| Index of Refraction | 1.558 |
| InChIKey | VOAJMYUEWCGJID-WRHRTGNFSA-N |
| SMILES | CC(CCC(O)C(C)(C)O)C1CCC2(C)C3=C(CCC12C)C1(C)CC(OC(=O)CC(C)(O)CC(=O)O)C(O)C(C)(C)C1CC3 |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| Fasciculic acid A |