Retinyl acetate structure
|
Common Name | Retinyl acetate | ||
|---|---|---|---|---|
| CAS Number | 127-47-9 | Molecular Weight | 328.488 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 440.5±14.0 °C at 760 mmHg | |
| Molecular Formula | C22H32O2 | Melting Point | 57-58 °C | |
| MSDS | Chinese USA | Flash Point | 124.8±18.5 °C | |
| Symbol |
GHS08 |
Signal Word | Danger | |
Use of Retinyl acetateRetinyl acetate is a natural form of vitamin A and has potential antineoplastic and chemo preventive activities. |
| Name | retinyl acetate |
|---|---|
| Synonym | More Synonyms |
| Description | Retinyl acetate is a natural form of vitamin A and has potential antineoplastic and chemo preventive activities. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 440.5±14.0 °C at 760 mmHg |
| Melting Point | 57-58 °C |
| Molecular Formula | C22H32O2 |
| Molecular Weight | 328.488 |
| Flash Point | 124.8±18.5 °C |
| Exact Mass | 328.240234 |
| PSA | 26.30000 |
| LogP | 7.39 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.532 |
| InChIKey | QGNJRVVDBSJHIZ-QHLGVNSISA-N |
| SMILES | CC(=O)OCC=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C |
| Storage condition | 2-8°C |
| Water Solubility | soluble |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H360-H413 |
| Precautionary Statements | P201-P308 + P313 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn:Harmful |
| Risk Phrases | R38;R63 |
| Safety Phrases | S36/37-S45 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 2 |
| RTECS | VH6825000 |
| HS Code | 2936210000 |
| Precursor 7 | |
|---|---|
| DownStream 9 | |
| HS Code | 2936210000 |
|---|
|
Simultaneous analysis for water- and fat-soluble vitamins by a novel single chromatography technique unifying supercritical fluid chromatography and liquid chromatography.
J. Chromatogr. A. 1362 , 270-7, (2014) Chromatography techniques usually use a single state in the mobile phase, such as liquid, gas, or supercritical fluid. Chromatographers manage one of these techniques for their purpose but are sometim... |
|
|
Effects of microbial phytase on apparent and standardized total tract digestibility of calcium in calcium supplements fed to growing pigs.
J. Anim. Sci. 93 , 2255-64, (2015) An experiment was conducted to test the hypothesis that differences in the apparent total tract digestibility (ATTD) and standardized total tract digestibility (STTD) of Ca exist among Ca supplements ... |
|
|
Ultra-performance liquid chromatographic determination of tocopherols and retinol in human plasma.
J. Chromatogr. Sci. 52(9) , 1065-70, (2014) A rapid, selective and sensitive ultra-performance liquid chromatography method has been developed for the detection and quantification of tocopherols and retinol in human plasma. Alpha-tocopherol, ga... |
| Retinol, acetate, all-trans- |
| all-trans-Retinyl acetate |
| Retinyl acetate, all-trans- |
| Vitamin A acetate (VAN) |
| all-trans-Vitamin A acetate |
| VITAMIN A1 ACETATE |
| Retinyl acetate |
| MFCD00019413 |
| trans-Vitamin A acetate |
| Retinol acetate,Retinyl acetate,Vitamin A acetate |
| Retinol, acetate |
| Retinol acetate |
| Myvax |
| O-Acetylretinol |
| Vitamin A, acetate |
| EINECS 204-844-2 |
| Myvak |
| Myvak (VAN) |
| Retinol, acetate, all-trans- (8CI) |
| Myvax (VAN) |
| Retinol, O-acetyl- |
| Vitamin A ester |
| VITAMIN A ACETATE |
| Retinol acetate (JP15) |
| all-trans-Retinol acetate |