Maleimide-NOTA structure
|
Common Name | Maleimide-NOTA | ||
|---|---|---|---|---|
| CAS Number | 1295584-83-6 | Molecular Weight | 425.44 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H27N5O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Maleimide-NOTAMaleimide-NOTA is a chelator for the labeling of peptides and antibodies. Maleimide-NOTA can react with cysteine[1]. |
| Name | Maleimide-NOTA |
|---|
| Description | Maleimide-NOTA is a chelator for the labeling of peptides and antibodies. Maleimide-NOTA can react with cysteine[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C18H27N5O7 |
|---|---|
| Molecular Weight | 425.44 |
| InChIKey | JZFBXLDURQNNQU-UHFFFAOYSA-N |
| SMILES | O=C(O)CN1CCN(CC(=O)O)CCN(CC(=O)NCCN2C(=O)C=CC2=O)CC1 |
| Storage condition | 2-8°C |