2-hydroxy-5-(trifluoromethoxy)benzoic acid structure
|
Common Name | 2-hydroxy-5-(trifluoromethoxy)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 129644-57-1 | Molecular Weight | 222.11800 | |
| Density | 1.577g/cm3 | Boiling Point | 291.7ºC at 760 mmHg | |
| Molecular Formula | C8H5F3O4 | Melting Point | 130-132 | |
| MSDS | N/A | Flash Point | 130.2ºC | |
| Name | 2-hydroxy-5-(trifluoromethoxy)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.577g/cm3 |
|---|---|
| Boiling Point | 291.7ºC at 760 mmHg |
| Melting Point | 130-132 |
| Molecular Formula | C8H5F3O4 |
| Molecular Weight | 222.11800 |
| Flash Point | 130.2ºC |
| Exact Mass | 222.01400 |
| PSA | 66.76000 |
| LogP | 1.98900 |
| Vapour Pressure | 0.000878mmHg at 25°C |
| Index of Refraction | 1.511 |
| InChIKey | HNYMLXYADOZCNY-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(OC(F)(F)F)ccc1O |
| Hazard Codes | Xi:Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2918990090 |
|
~88%
2-hydroxy-5-(tr... CAS#:129644-57-1 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 12, # 21 p. 5661 - 5675 |
|
~%
2-hydroxy-5-(tr... CAS#:129644-57-1 |
| Literature: US2005/261342 A1, ; Page/Page column 11 ; US 20050261342 A1 |
|
~83%
2-hydroxy-5-(tr... CAS#:129644-57-1 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 44, # 4 p. 734 - 745 |
|
~%
2-hydroxy-5-(tr... CAS#:129644-57-1 |
| Literature: Tetrahedron, , vol. 61, # 13 p. 3393 - 3401 |
|
~%
2-hydroxy-5-(tr... CAS#:129644-57-1 |
| Literature: Tetrahedron, , vol. 61, # 13 p. 3393 - 3401 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-(trifluoromethoxy)salicylic acid |
| 2-hydroxy-5-trifluoromethoxy-benzoic acid |
| MFCD01091003 |