3β,5α-Dihydroxycholestan-6-one structure
|
Common Name | 3β,5α-Dihydroxycholestan-6-one | ||
|---|---|---|---|---|
| CAS Number | 13027-33-3 | Molecular Weight | 418.652 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 528.9±45.0 °C at 760 mmHg | |
| Molecular Formula | C27H46O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 287.7±25.2 °C | |
Use of 3β,5α-Dihydroxycholestan-6-one5α-Hydroxy-6-keto cholesterol is major metabolite of β-epoxide (5α,6β-epoxycholesterol) during direct exposure of intact cultured human bronchial epithelial cells (16-HBE) to ozone. 5α-Hydroxy-6-keto cholesterol inhibits cholesterol synthesis with an IC50 of 350 nM[1]. |
| Name | 5alpha-cholestan-3beta,5alpha-diol-6-one |
|---|---|
| Synonym | More Synonyms |
| Description | 5α-Hydroxy-6-keto cholesterol is major metabolite of β-epoxide (5α,6β-epoxycholesterol) during direct exposure of intact cultured human bronchial epithelial cells (16-HBE) to ozone. 5α-Hydroxy-6-keto cholesterol inhibits cholesterol synthesis with an IC50 of 350 nM[1]. |
|---|---|
| Related Catalog | |
| In Vitro | 5α-Hydroxy-6-keto cholesterol (0.01, 0.1, 1, 10 μM) is cytotoxic to cultured 16-HBE cells[1]. |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 528.9±45.0 °C at 760 mmHg |
| Molecular Formula | C27H46O3 |
| Molecular Weight | 418.652 |
| Flash Point | 287.7±25.2 °C |
| Exact Mass | 418.344696 |
| PSA | 57.53000 |
| LogP | 7.00 |
| Vapour Pressure | 0.0±3.2 mmHg at 25°C |
| Index of Refraction | 1.531 |
| InChIKey | SJZZRXMQSAXCFD-ZCBMJONGSA-N |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC(=O)C4(O)CC(O)CCC4(C)C3CCC12C |
| CHOLESTANE-6-OXO-3,5-DIOL |
| Cholestan-6-one, 3,5-dihydroxy-, (3β,5α)- |
| (3β,5α)-3,5-Dihydroxycholestan-6-one |
| CHOLESTANE-6-OXO-3BETA,5ALPHA-DIOL |
| 5ALPHA-HYDROXY-6-KETO CHOLESTEROL |
| YS-64 |
| yakkasterone |
| 3β,5α-Dihydroxycholestan-6-one |