Decursinol angelate structure
|
Common Name | Decursinol angelate | ||
|---|---|---|---|---|
| CAS Number | 130848-06-5 | Molecular Weight | 328.359 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 469.4±45.0 °C at 760 mmHg | |
| Molecular Formula | C19H20O5 | Melting Point | 93-94 ºC | |
| MSDS | N/A | Flash Point | 206.6±28.8 °C | |
Use of Decursinol angelateDecursinol angelate, a cytotoxic and protein kinase C (PKC) activating agent from the root of Angelica gigas, possesses anti-tumor and anti-inflammatory activities[1][2]. |
| Name | LXU5241LCL |
|---|---|
| Synonym | More Synonyms |
| Description | Decursinol angelate, a cytotoxic and protein kinase C (PKC) activating agent from the root of Angelica gigas, possesses anti-tumor and anti-inflammatory activities[1][2]. |
|---|---|
| Related Catalog | |
| Target |
PKC[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 469.4±45.0 °C at 760 mmHg |
| Melting Point | 93-94 ºC |
| Molecular Formula | C19H20O5 |
| Molecular Weight | 328.359 |
| Flash Point | 206.6±28.8 °C |
| Exact Mass | 328.131073 |
| LogP | 4.57 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.580 |
| InChIKey | AGABNGOXUSXQDD-XKGFZTIGSA-N |
| SMILES | CC=C(C)C(=O)OC1Cc2cc3ccc(=O)oc3cc2OC1(C)C |
| Storage condition | -20℃ |
| Water Solubility | Practically insoluble (0.031 g/L) (25 ºC) |
| 2-Butenoic acid, 2-methyl-, (7S)-7,8-dihydro-8,8-dimethyl-2-oxo-2H,6H-benzo[1,2-b:5,4-b']dipyran-7-yl ester, (2Z)- |
| (7S)-8,8-Dimethyl-2-oxo-7,8-dihydro-2H,6H-pyrano[3,2-g]chromen-7-yl (2Z)-2-methyl-2-butenoate |
| LXU5241LCL |
| MFCD06796687 |
| Decursinol angelate |